C22H23FN4O5S — CID 22505281
1-[3-[4-(4-fluorophenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]cyclohexyl]-1-hydroxyurea (PubChem CID 22505281) has the molecular formula C22H23FN4O5S and a molecular weight of 474.51 g/mol. Its IUPAC name is 1-[3-[4-(4-fluorophenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]cyclohexyl]-1-hydroxyurea.
| Compound Name | 1-[3-[4-(4-fluorophenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]cyclohexyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 22505281 |
| Molecular Formula | C22H23FN4O5S |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 1-[3-[4-(4-fluorophenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]cyclohexyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)C1CCCC(c2nc(-c3ccc(F)cc3)c(-c3ccccc3S(N)(=O)=O)o2)C1 |
| InChI | InChI=1S/C22H23FN4O5S/c23-15-10-8-13(9-11-15)19-20(17-6-1-2-7-18(17)33(25,30)31)32-21(26-19)14-4-3-5-16(12-14)27(29)22(24)28/h1-2,6-11,14,16,29H,3-5,12H2,(H2,24,28)(H2,25,30,31) |
| InChIKey | LOBAIPOWOFCANL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 152.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|