About N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide
N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide (PubChem CID 22505284) has the molecular formula C20H21N3O5S
and a molecular weight of 415.47 g/mol. Its IUPAC name is N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide.
Molecular Properties
| Compound Name | N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide |
| PubChem CID | 22505284 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide |
| SMILES | CN(O)C(=O)CCCc1nc(-c2ccccc2)c(-c2ccccc2S(N)(=O)=O)o1 |
| InChI | InChI=1S/C20H21N3O5S/c1-23(25)18(24)13-7-12-17-22-19(14-8-3-2-4-9-14)20(28-17)15-10-5-6-11-16(15)29(21,26)27/h2-6,8-11,25H,7,12-13H2,1H3,(H2,21,26,27) |
| InChIKey | NATDFGQWUNXFFB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide?
The IUPAC name of N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide (CID 22505284) is N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide.
What is the SMILES notation for N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide?
The canonical SMILES for N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide is CN(O)C(=O)CCCc1nc(-c2ccccc2)c(-c2ccccc2S(N)(=O)=O)o1.
What is the InChIKey of N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide?
The InChIKey is NATDFGQWUNXFFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O5S/c1-23(25)18(24)13-7-12-17-22-19(14-8-3-2-4-9-14)20(28-17)15-10-5-6-11-16(15)29(21,26)27/h2-6,8-11,25H,7,12-13H2,1H3,(H2,21,26,27).
What are the key properties of N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide?
N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide has a molecular weight of 415.47 g/mol, XLogP of 2.83, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N-methyl-4-[4-phenyl-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]butanamide is sourced from PubChem (CID 22505284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).