About 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol
2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol (PubChem CID 22506053) has the molecular formula C11H13N3OS
and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol.
Molecular Properties
| Compound Name | 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol |
| PubChem CID | 22506053 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol |
| SMILES | Nc1ccc(NCCO)cc1-c1nccs1 |
| InChI | InChI=1S/C11H13N3OS/c12-10-2-1-8(13-3-5-15)7-9(10)11-14-4-6-16-11/h1-2,4,6-7,13,15H,3,5,12H2 |
| InChIKey | WSCUIYNHEWVGHC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol?
The IUPAC name of 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol (CID 22506053) is 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol.
What is the SMILES notation for 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol?
The canonical SMILES for 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol is Nc1ccc(NCCO)cc1-c1nccs1.
What is the InChIKey of 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol?
The InChIKey is WSCUIYNHEWVGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3OS/c12-10-2-1-8(13-3-5-15)7-9(10)11-14-4-6-16-11/h1-2,4,6-7,13,15H,3,5,12H2.
What are the key properties of 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol?
2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol has a molecular weight of 235.31 g/mol, XLogP of 1.80, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-amino-3-(1,3-thiazol-2-yl)anilino]ethanol is sourced from PubChem (CID 22506053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).