About CID 22506301
CID 22506301 (PubChem CID 22506301) has the molecular formula C7H17N2OSi
and a molecular weight of 173.31 g/mol.
Molecular Properties
| Compound Name | CID 22506301 |
| PubChem CID | 22506301 |
| Molecular Formula | C7H17N2OSi |
| Molecular Weight | 173.31 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | — |
| SMILES | CC(N)NC1CCC1.CO[Si] |
| InChI | InChI=1S/C6H14N2.CH3OSi/c1-5(7)8-6-3-2-4-6;1-2-3/h5-6,8H,2-4,7H2,1H3;1H3 |
| InChIKey | OWHPSKCAMQLERF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 22506301 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22506301?
The IUPAC name of CID 22506301 (CID 22506301) is not available.
What is the SMILES notation for CID 22506301?
The canonical SMILES for CID 22506301 is CC(N)NC1CCC1.CO[Si].
What is the InChIKey of CID 22506301?
The InChIKey is OWHPSKCAMQLERF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.CH3OSi/c1-5(7)8-6-3-2-4-6;1-2-3/h5-6,8H,2-4,7H2,1H3;1H3.
What are the key properties of CID 22506301?
CID 22506301 has a molecular weight of 173.31 g/mol, XLogP of 0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22506301 is sourced from PubChem (CID 22506301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).