C14H12F12O2 — CID 22506486
bis(1,1,1,3,3,3-hexafluoropropan-2-ol);styrene (PubChem CID 22506486) has the molecular formula C14H12F12O2 and a molecular weight of 440.22 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-ol);styrene.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-ol);styrene |
|---|---|
| PubChem CID | 22506486 |
| Molecular Formula | C14H12F12O2 |
| Molecular Weight | 440.22 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-ol);styrene |
| SMILES | C=Cc1ccccc1.OC(C(F)(F)F)C(F)(F)F.OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8.2C3H2F6O/c1-2-8-6-4-3-5-7-8;2*4-2(5,6)1(10)3(7,8)9/h2-7H,1H2;2*1,10H |
| InChIKey | YLNOLZNGKLLLQF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.22 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |