C14H16F3NO3 — CID 22506879
2,2,2-trifluoro-N-[2-(5-methyl-3,6-dioxo-2-propan-2-ylcyclohexa-1,4-dien-1-yl)ethyl]acetamide (PubChem CID 22506879) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(5-methyl-3,6-dioxo-2-propan-2-ylcyclohexa-1,4-dien-1-yl)ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(5-methyl-3,6-dioxo-2-propan-2-ylcyclohexa-1,4-dien-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 22506879 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(5-methyl-3,6-dioxo-2-propan-2-ylcyclohexa-1,4-dien-1-yl)ethyl]acetamide |
| SMILES | CC1=CC(=O)C(C(C)C)=C(CCNC(=O)C(F)(F)F)C1=O |
| InChI | InChI=1S/C14H16F3NO3/c1-7(2)11-9(12(20)8(3)6-10(11)19)4-5-18-13(21)14(15,16)17/h6-7H,4-5H2,1-3H3,(H,18,21) |
| InChIKey | NGIHDBGVBOPLKT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|