About 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole
5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole (PubChem CID 22506880) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole |
| PubChem CID | 22506880 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole |
| SMILES | COc1cc(C)c2c(c1C)CCN2 |
| InChI | InChI=1S/C11H15NO/c1-7-6-10(13-3)8(2)9-4-5-12-11(7)9/h6,12H,4-5H2,1-3H3 |
| InChIKey | SXTVXTGVVXTIIN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole?
The IUPAC name of 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole (CID 22506880) is 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole?
The canonical SMILES for 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole is COc1cc(C)c2c(c1C)CCN2.
What is the InChIKey of 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole?
The InChIKey is SXTVXTGVVXTIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-7-6-10(13-3)8(2)9-4-5-12-11(7)9/h6,12H,4-5H2,1-3H3.
What are the key properties of 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole?
5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole has a molecular weight of 177.25 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4,7-dimethyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 22506880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).