About 6-oxocyclohexa-1,3-diene-1-carbohydrazide
6-oxocyclohexa-1,3-diene-1-carbohydrazide (PubChem CID 22507405) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 6-oxocyclohexa-1,3-diene-1-carbohydrazide.
Molecular Properties
| Compound Name | 6-oxocyclohexa-1,3-diene-1-carbohydrazide |
| PubChem CID | 22507405 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 6-oxocyclohexa-1,3-diene-1-carbohydrazide |
| SMILES | NNC(=O)C1=CC=CCC1=O |
| InChI | InChI=1S/C7H8N2O2/c8-9-7(11)5-3-1-2-4-6(5)10/h1-3H,4,8H2,(H,9,11) |
| InChIKey | CHTRXARADREYMR-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-oxocyclohexa-1,3-diene-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxocyclohexa-1,3-diene-1-carbohydrazide?
The IUPAC name of 6-oxocyclohexa-1,3-diene-1-carbohydrazide (CID 22507405) is 6-oxocyclohexa-1,3-diene-1-carbohydrazide.
What is the SMILES notation for 6-oxocyclohexa-1,3-diene-1-carbohydrazide?
The canonical SMILES for 6-oxocyclohexa-1,3-diene-1-carbohydrazide is NNC(=O)C1=CC=CCC1=O.
What is the InChIKey of 6-oxocyclohexa-1,3-diene-1-carbohydrazide?
The InChIKey is CHTRXARADREYMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c8-9-7(11)5-3-1-2-4-6(5)10/h1-3H,4,8H2,(H,9,11).
What are the key properties of 6-oxocyclohexa-1,3-diene-1-carbohydrazide?
6-oxocyclohexa-1,3-diene-1-carbohydrazide has a molecular weight of 152.15 g/mol, XLogP of -0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxocyclohexa-1,3-diene-1-carbohydrazide is sourced from PubChem (CID 22507405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).