C10H9N5O — CID 22507462
2-(4,6-diamino-1,3,5-triazin-2-yl)benzaldehyde (PubChem CID 22507462) has the molecular formula C10H9N5O and a molecular weight of 215.22 g/mol. Its IUPAC name is 2-(4,6-diamino-1,3,5-triazin-2-yl)benzaldehyde.
| Compound Name | 2-(4,6-diamino-1,3,5-triazin-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 22507462 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-(4,6-diamino-1,3,5-triazin-2-yl)benzaldehyde |
| SMILES | Nc1nc(N)nc(-c2ccccc2C=O)n1 |
| InChI | InChI=1S/C10H9N5O/c11-9-13-8(14-10(12)15-9)7-4-2-1-3-6(7)5-16/h1-5H,(H4,11,12,13,14,15) |
| InChIKey | SAGQMEPFJAEKOB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|