C9H16F3NO3 — CID 22507710
4-(methoxymethyl)piperidine;2,2,2-trifluoroacetic acid (PubChem CID 22507710) has the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 4-(methoxymethyl)piperidine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(methoxymethyl)piperidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22507710 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4-(methoxymethyl)piperidine;2,2,2-trifluoroacetic acid |
| SMILES | COCC1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H15NO.C2HF3O2/c1-9-6-7-2-4-8-5-3-7;3-2(4,5)1(6)7/h7-8H,2-6H2,1H3;(H,6,7) |
| InChIKey | SWVXICXVQDJFRV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |