C19H17FN2O4S — CID 22507764
N-[7-(1,4-dioxan-2-yl)-4-methoxy-1,3-benzothiazol-2-yl]-3-fluorobenzamide (PubChem CID 22507764) has the molecular formula C19H17FN2O4S and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[7-(1,4-dioxan-2-yl)-4-methoxy-1,3-benzothiazol-2-yl]-3-fluorobenzamide.
| Compound Name | N-[7-(1,4-dioxan-2-yl)-4-methoxy-1,3-benzothiazol-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 22507764 |
| Molecular Formula | C19H17FN2O4S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[7-(1,4-dioxan-2-yl)-4-methoxy-1,3-benzothiazol-2-yl]-3-fluorobenzamide |
| SMILES | COc1ccc(C2COCCO2)c2sc(NC(=O)c3cccc(F)c3)nc12 |
| InChI | InChI=1S/C19H17FN2O4S/c1-24-14-6-5-13(15-10-25-7-8-26-15)17-16(14)21-19(27-17)22-18(23)11-3-2-4-12(20)9-11/h2-6,9,15H,7-8,10H2,1H3,(H,21,22,23) |
| InChIKey | XXWNLFPIAKVSGF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |