C19H26N8+2 — CID 2250779
3-ethyl-2-[(3-ethyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)methyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium (PubChem CID 2250779) has the molecular formula C19H26N8+2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 3-ethyl-2-[(3-ethyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)methyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium.
| Compound Name | 3-ethyl-2-[(3-ethyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)methyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium |
|---|---|
| PubChem CID | 2250779 |
| Molecular Formula | C19H26N8+2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 3-ethyl-2-[(3-ethyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)methyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium |
| SMILES | CC[n+]1c(Cc2nn3c(C)cc(C)nc3[n+]2CC)nn2c(C)cc(C)nc21 |
| InChI | InChI=1S/C19H26N8/c1-7-24-16(22-26-14(5)9-12(3)20-18(24)26)11-17-23-27-15(6)10-13(4)21-19(27)25(17)8-2/h9-10H,7-8,11H2,1-6H3/q+2 |
| InChIKey | VLFWYLGVRYRTSC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 68.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|