About 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol
4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol (PubChem CID 22508138) has the molecular formula C21H20O2
and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol.
Molecular Properties
| Compound Name | 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol |
| PubChem CID | 22508138 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol |
| SMILES | Cc1cc(-c2ccc(-c3ccc(O)cc3)cc2)c(C)c(C)c1O |
| InChI | InChI=1S/C21H20O2/c1-13-12-20(14(2)15(3)21(13)23)18-6-4-16(5-7-18)17-8-10-19(22)11-9-17/h4-12,22-23H,1-3H3 |
| InChIKey | RTMTYRMBMPJKLP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol?
The IUPAC name of 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol (CID 22508138) is 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol.
What is the SMILES notation for 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol?
The canonical SMILES for 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol is Cc1cc(-c2ccc(-c3ccc(O)cc3)cc2)c(C)c(C)c1O.
What is the InChIKey of 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol?
The InChIKey is RTMTYRMBMPJKLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O2/c1-13-12-20(14(2)15(3)21(13)23)18-6-4-16(5-7-18)17-8-10-19(22)11-9-17/h4-12,22-23H,1-3H3.
What are the key properties of 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol?
4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol has a molecular weight of 304.39 g/mol, XLogP of 5.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-hydroxyphenyl)phenyl]-2,3,6-trimethylphenol is sourced from PubChem (CID 22508138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).