C18H26O4S2 — CID 22508376
dimethyl(phenyl)sulfanium;4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate (PubChem CID 22508376) has the molecular formula C18H26O4S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is dimethyl(phenyl)sulfanium;4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate.
| Compound Name | dimethyl(phenyl)sulfanium;4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate |
|---|---|
| PubChem CID | 22508376 |
| Molecular Formula | C18H26O4S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | dimethyl(phenyl)sulfanium;4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate |
| SMILES | CC12CCC(C(S(=O)(=O)[O-])C1=O)C2(C)C.C[S+](C)c1ccccc1 |
| InChI | InChI=1S/C10H16O4S.C8H11S/c1-9(2)6-4-5-10(9,3)8(11)7(6)15(12,13)14;1-9(2)8-6-4-3-5-7-8/h6-7H,4-5H2,1-3H3,(H,12,13,14);3-7H,1-2H3/q;+1/p-1 |
| InChIKey | IXRHVLNJMXYRPW-UHFFFAOYSA-M |
| XLogP | 2.85 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|