About 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate
4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate (PubChem CID 22508392) has the molecular formula C24H32O3
and a molecular weight of 368.52 g/mol. Its IUPAC name is 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate |
| PubChem CID | 22508392 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CC)C2CC3CC(C2)CC1C3.C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C16H24O2.C8H8O/c1-4-16(18-15(17)10(2)3)13-6-11-5-12(8-13)9-14(16)7-11;1-2-7-3-5-8(9)6-4-7/h11-14H,2,4-9H2,1,3H3;2-6,9H,1H2 |
| InChIKey | CHTUFNJOVZQWQX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate?
The IUPAC name of 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate (CID 22508392) is 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate.
What is the SMILES notation for 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate?
The canonical SMILES for 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate is C=C(C)C(=O)OC1(CC)C2CC3CC(C2)CC1C3.C=Cc1ccc(O)cc1.
What is the InChIKey of 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate?
The InChIKey is CHTUFNJOVZQWQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O2.C8H8O/c1-4-16(18-15(17)10(2)3)13-6-11-5-12(8-13)9-14(16)7-11;1-2-7-3-5-8(9)6-4-7/h11-14H,2,4-9H2,1,3H3;2-6,9H,1H2.
What are the key properties of 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate?
4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate has a molecular weight of 368.52 g/mol, XLogP of 5.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylphenol;(2-ethyl-2-adamantyl) 2-methylprop-2-enoate is sourced from PubChem (CID 22508392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).