C20H21FN4O3S — CID 22508860
4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-methylsulfinylpropoxy)pyrrolo[2,1-f][1,2,4]triazine (PubChem CID 22508860) has the molecular formula C20H21FN4O3S and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-methylsulfinylpropoxy)pyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-methylsulfinylpropoxy)pyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 22508860 |
| Molecular Formula | C20H21FN4O3S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-methylsulfinylpropoxy)pyrrolo[2,1-f][1,2,4]triazine |
| SMILES | Cc1cc2c(F)c(Oc3ncnn4cc(OCCCS(C)=O)c(C)c34)ccc2[nH]1 |
| InChI | InChI=1S/C20H21FN4O3S/c1-12-9-14-15(24-12)5-6-16(18(14)21)28-20-19-13(2)17(10-25(19)23-11-22-20)27-7-4-8-29(3)26/h5-6,9-11,24H,4,7-8H2,1-3H3 |
| InChIKey | NITGHBQGHFGWPO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|