C23H18F3N3O — CID 22509055
6-(3-phenylprop-2-ynyl)-3-[(3,4,5-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 22509055) has the molecular formula C23H18F3N3O and a molecular weight of 409.41 g/mol. Its IUPAC name is 6-(3-phenylprop-2-ynyl)-3-[(3,4,5-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-(3-phenylprop-2-ynyl)-3-[(3,4,5-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 22509055 |
| Molecular Formula | C23H18F3N3O |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 6-(3-phenylprop-2-ynyl)-3-[(3,4,5-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(ncn1Cc1cc(F)c(F)c(F)c1)CCN(CC#Cc1ccccc1)C2 |
| InChI | InChI=1S/C23H18F3N3O/c24-19-11-17(12-20(25)22(19)26)13-29-15-27-21-8-10-28(14-18(21)23(29)30)9-4-7-16-5-2-1-3-6-16/h1-3,5-6,11-12,15H,8-10,13-14H2 |
| InChIKey | JSFZDCIEOUJIIS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|