C24H23N3O5S — CID 22509150
4-[[1-methyl-2,4-dioxo-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-3-yl]methyl]benzenesulfonic acid (PubChem CID 22509150) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is 4-[[1-methyl-2,4-dioxo-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-3-yl]methyl]benzenesulfonic acid.
| Compound Name | 4-[[1-methyl-2,4-dioxo-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-3-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 22509150 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 4-[[1-methyl-2,4-dioxo-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-3-yl]methyl]benzenesulfonic acid |
| SMILES | Cn1c2c(c(=O)n(Cc3ccc(S(=O)(=O)O)cc3)c1=O)CN(CC#Cc1ccccc1)CC2 |
| InChI | InChI=1S/C24H23N3O5S/c1-25-22-13-15-26(14-5-8-18-6-3-2-4-7-18)17-21(22)23(28)27(24(25)29)16-19-9-11-20(12-10-19)33(30,31)32/h2-4,6-7,9-12H,13-17H2,1H3,(H,30,31,32) |
| InChIKey | JUZLQFSIPRVCBA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|