C23H21N3O4S — CID 22509164
4-[[4-oxo-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-3-yl]methyl]benzenesulfonic acid (PubChem CID 22509164) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is 4-[[4-oxo-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-3-yl]methyl]benzenesulfonic acid.
| Compound Name | 4-[[4-oxo-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-3-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 22509164 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 4-[[4-oxo-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-3-yl]methyl]benzenesulfonic acid |
| SMILES | O=c1c2c(ncn1Cc1ccc(S(=O)(=O)O)cc1)CCN(CC#Cc1ccccc1)C2 |
| InChI | InChI=1S/C23H21N3O4S/c27-23-21-16-25(13-4-7-18-5-2-1-3-6-18)14-12-22(21)24-17-26(23)15-19-8-10-20(11-9-19)31(28,29)30/h1-3,5-6,8-11,17H,12-16H2,(H,28,29,30) |
| InChIKey | YGKYTNHZCJWSHW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|