C26H28N4O — CID 22509166
3-[[4-(aziridin-1-yl)phenyl]methyl]-1-methyl-6-(3-phenylprop-2-ynyl)-2,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 22509166) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-[[4-(aziridin-1-yl)phenyl]methyl]-1-methyl-6-(3-phenylprop-2-ynyl)-2,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 3-[[4-(aziridin-1-yl)phenyl]methyl]-1-methyl-6-(3-phenylprop-2-ynyl)-2,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 22509166 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 3-[[4-(aziridin-1-yl)phenyl]methyl]-1-methyl-6-(3-phenylprop-2-ynyl)-2,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CN1CN(Cc2ccc(N3CC3)cc2)C(=O)C2=C1CCN(CC#Cc1ccccc1)C2 |
| InChI | InChI=1S/C26H28N4O/c1-27-20-30(18-22-9-11-23(12-10-22)29-16-17-29)26(31)24-19-28(15-13-25(24)27)14-5-8-21-6-3-2-4-7-21/h2-4,6-7,9-12H,13-20H2,1H3 |
| InChIKey | XWPBJAAOQJLPIM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|