C25H26N4O — CID 22509270
3-[[4-(dimethylamino)phenyl]methyl]-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 22509270) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)phenyl]methyl]-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 3-[[4-(dimethylamino)phenyl]methyl]-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 22509270 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-[[4-(dimethylamino)phenyl]methyl]-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | CN(C)c1ccc(Cn2cnc3c(c2=O)CN(CC#Cc2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C25H26N4O/c1-27(2)22-12-10-21(11-13-22)17-29-19-26-24-14-16-28(18-23(24)25(29)30)15-6-9-20-7-4-3-5-8-20/h3-5,7-8,10-13,19H,14-18H2,1-2H3 |
| InChIKey | MLFQPTXMHRBAQL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|