C18H18ClN3O — CID 22509911
N-[2-(4-chlorophenyl)ethyl]-2-(6-methylindazol-1-yl)acetamide (PubChem CID 22509911) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-(6-methylindazol-1-yl)acetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-(6-methylindazol-1-yl)acetamide |
|---|---|
| PubChem CID | 22509911 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-(6-methylindazol-1-yl)acetamide |
| SMILES | Cc1ccc2cnn(CC(=O)NCCc3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C18H18ClN3O/c1-13-2-5-15-11-21-22(17(15)10-13)12-18(23)20-9-8-14-3-6-16(19)7-4-14/h2-7,10-11H,8-9,12H2,1H3,(H,20,23) |
| InChIKey | UNDURKFMPCTJRV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |