About 3-methyloctan-2-one
3-methyloctan-2-one (PubChem CID 22511) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 3-methyloctan-2-one.
Molecular Properties
| Compound Name | 3-methyloctan-2-one |
| PubChem CID | 22511 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 3-methyloctan-2-one |
| SMILES | CCCCCC(C)C(C)=O |
| InChI | InChI=1S/C9H18O/c1-4-5-6-7-8(2)9(3)10/h8H,4-7H2,1-3H3 |
| InChIKey | XSWHAOGCTCBDIT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyloctan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyloctan-2-one?
The IUPAC name of 3-methyloctan-2-one (CID 22511) is 3-methyloctan-2-one.
What is the SMILES notation for 3-methyloctan-2-one?
The canonical SMILES for 3-methyloctan-2-one is CCCCCC(C)C(C)=O.
What is the InChIKey of 3-methyloctan-2-one?
The InChIKey is XSWHAOGCTCBDIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-4-5-6-7-8(2)9(3)10/h8H,4-7H2,1-3H3.
What are the key properties of 3-methyloctan-2-one?
3-methyloctan-2-one has a molecular weight of 142.24 g/mol, XLogP of 2.79, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyloctan-2-one is sourced from PubChem (CID 22511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).