About 4-methylheptan-3-one
4-methylheptan-3-one (PubChem CID 22512) has the molecular formula C8H16O
and a molecular weight of 128.21 g/mol. Its IUPAC name is 4-methylheptan-3-one.
Molecular Properties
| Compound Name | 4-methylheptan-3-one |
| PubChem CID | 22512 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | 4-methylheptan-3-one |
| SMILES | CCCC(C)C(=O)CC |
| InChI | InChI=1S/C8H16O/c1-4-6-7(3)8(9)5-2/h7H,4-6H2,1-3H3 |
| InChIKey | MVLRILUUXLBENA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylheptan-3-one?
The IUPAC name of 4-methylheptan-3-one (CID 22512) is 4-methylheptan-3-one.
What is the SMILES notation for 4-methylheptan-3-one?
The canonical SMILES for 4-methylheptan-3-one is CCCC(C)C(=O)CC.
What is the InChIKey of 4-methylheptan-3-one?
The InChIKey is MVLRILUUXLBENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O/c1-4-6-7(3)8(9)5-2/h7H,4-6H2,1-3H3.
What are the key properties of 4-methylheptan-3-one?
4-methylheptan-3-one has a molecular weight of 128.21 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptan-3-one is sourced from PubChem (CID 22512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).