About N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine
N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine (PubChem CID 22512499) has the molecular formula C17H16N2O3S
and a molecular weight of 328.39 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine.
Molecular Properties
| Compound Name | N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine |
| PubChem CID | 22512499 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine |
| SMILES | COc1ccc(NC2=NS(=O)(=O)C(c3ccccc3)=C2C)cc1 |
| InChI | InChI=1S/C17H16N2O3S/c1-12-16(13-6-4-3-5-7-13)23(20,21)19-17(12)18-14-8-10-15(22-2)11-9-14/h3-11H,1-2H3,(H,18,19) |
| InChIKey | ONISMAWSXYBDBG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine?
The IUPAC name of N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine (CID 22512499) is N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine.
What is the SMILES notation for N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine?
The canonical SMILES for N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine is COc1ccc(NC2=NS(=O)(=O)C(c3ccccc3)=C2C)cc1.
What is the InChIKey of N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine?
The InChIKey is ONISMAWSXYBDBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O3S/c1-12-16(13-6-4-3-5-7-13)23(20,21)19-17(12)18-14-8-10-15(22-2)11-9-14/h3-11H,1-2H3,(H,18,19).
What are the key properties of N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine?
N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine has a molecular weight of 328.39 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine is sourced from PubChem (CID 22512499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).