C26H33ClN4O3 — CID 22512761
N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide (PubChem CID 22512761) has the molecular formula C26H33ClN4O3 and a molecular weight of 485.03 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 22512761 |
| Molecular Formula | C26H33ClN4O3 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)N1CCOc2ccc(Cl)cc21)NCCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H33ClN4O3/c27-22-7-8-24-23(19-22)31(17-18-34-24)26(33)10-9-25(32)28-11-4-12-29-13-15-30(16-14-29)20-21-5-2-1-3-6-21/h1-3,5-8,19H,4,9-18,20H2,(H,28,32) |
| InChIKey | ASFKOVZMBKIMPB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|