C27H35ClN4O3 — CID 22512808
N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(6-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide (PubChem CID 22512808) has the molecular formula C27H35ClN4O3 and a molecular weight of 499.06 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(6-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(6-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 22512808 |
| Molecular Formula | C27H35ClN4O3 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(6-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide |
| SMILES | CC1CN(C(=O)CCC(=O)NCCCN2CCN(Cc3ccccc3)CC2)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C27H35ClN4O3/c1-21-19-32(24-18-23(28)8-9-25(24)35-21)27(34)11-10-26(33)29-12-5-13-30-14-16-31(17-15-30)20-22-6-3-2-4-7-22/h2-4,6-9,18,21H,5,10-17,19-20H2,1H3,(H,29,33) |
| InChIKey | STFRTILQSUIZEX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|