C22H34N4O3 — CID 22512869
4-(2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxobutanamide (PubChem CID 22512869) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is 4-(2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxobutanamide.
| Compound Name | 4-(2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 22512869 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 4-(2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxobutanamide |
| SMILES | Cc1ccc2c(c1)N(C(=O)CCC(=O)NCCCN1CCN(C)CC1)CC(C)O2 |
| InChI | InChI=1S/C22H34N4O3/c1-17-5-6-20-19(15-17)26(16-18(2)29-20)22(28)8-7-21(27)23-9-4-10-25-13-11-24(3)12-14-25/h5-6,15,18H,4,7-14,16H2,1-3H3,(H,23,27) |
| InChIKey | CFWZYOAUKCCULO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|