C23H36N4O3 — CID 22512873
4-(2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]-4-oxobutanamide (PubChem CID 22512873) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-(2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]-4-oxobutanamide.
| Compound Name | 4-(2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 22512873 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 4-(2,6-dimethyl-2,3-dihydro-1,4-benzoxazin-4-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]-4-oxobutanamide |
| SMILES | CCN1CCN(CCCNC(=O)CCC(=O)N2CC(C)Oc3ccc(C)cc32)CC1 |
| InChI | InChI=1S/C23H36N4O3/c1-4-25-12-14-26(15-13-25)11-5-10-24-22(28)8-9-23(29)27-17-19(3)30-21-7-6-18(2)16-20(21)27/h6-7,16,19H,4-5,8-15,17H2,1-3H3,(H,24,28) |
| InChIKey | YWWPYKCJOQGVEY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|