C28H37N3O3 — CID 22512946
N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide (PubChem CID 22512946) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 22512946 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide |
| SMILES | Cc1ccc2c(c1)N(C(=O)CCC(=O)NCCCN1CCC(Cc3ccccc3)CC1)CCO2 |
| InChI | InChI=1S/C28H37N3O3/c1-22-8-9-26-25(20-22)31(18-19-34-26)28(33)11-10-27(32)29-14-5-15-30-16-12-24(13-17-30)21-23-6-3-2-4-7-23/h2-4,6-9,20,24H,5,10-19,21H2,1H3,(H,29,32) |
| InChIKey | RJZNQJVLIVSQNQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|