C27H32N4O2S — CID 22514307
N-[3-(N-ethyl-3-methylanilino)propyl]-4-(4-methyl-1-oxo-[1]benzothiolo[2,3-d]pyridazin-2-yl)butanamide (PubChem CID 22514307) has the molecular formula C27H32N4O2S and a molecular weight of 476.65 g/mol. Its IUPAC name is N-[3-(N-ethyl-3-methylanilino)propyl]-4-(4-methyl-1-oxo-[1]benzothiolo[2,3-d]pyridazin-2-yl)butanamide.
| Compound Name | N-[3-(N-ethyl-3-methylanilino)propyl]-4-(4-methyl-1-oxo-[1]benzothiolo[2,3-d]pyridazin-2-yl)butanamide |
|---|---|
| PubChem CID | 22514307 |
| Molecular Formula | C27H32N4O2S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | N-[3-(N-ethyl-3-methylanilino)propyl]-4-(4-methyl-1-oxo-[1]benzothiolo[2,3-d]pyridazin-2-yl)butanamide |
| SMILES | CCN(CCCNC(=O)CCCn1nc(C)c2sc3ccccc3c2c1=O)c1cccc(C)c1 |
| InChI | InChI=1S/C27H32N4O2S/c1-4-30(21-11-7-10-19(2)18-21)16-9-15-28-24(32)14-8-17-31-27(33)25-22-12-5-6-13-23(22)34-26(25)20(3)29-31/h5-7,10-13,18H,4,8-9,14-17H2,1-3H3,(H,28,32) |
| InChIKey | KNUZCOKXKCVNRC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|