C22H24N4O5S — CID 2251509
N,N-diethyl-4-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]-3-methylbenzenesulfonamide (PubChem CID 2251509) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is N,N-diethyl-4-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]-3-methylbenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2251509 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N,N-diethyl-4-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]-3-methylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/N=C/c2c(O)n(-c3ccccc3)c(=O)[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C22H24N4O5S/c1-4-25(5-2)32(30,31)17-11-12-19(15(3)13-17)23-14-18-20(27)24-22(29)26(21(18)28)16-9-7-6-8-10-16/h6-14,28H,4-5H2,1-3H3,(H,24,27,29)/b23-14+ |
| InChIKey | VZIRTYHPTXSBRK-OEAKJJBVSA-N |
| XLogP | 2.32 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|