C20H22N4O3S — CID 22515510
2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-2-oxoacetamide (PubChem CID 22515510) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-2-oxoacetamide.
| Compound Name | 2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 22515510 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-2-oxoacetamide |
| SMILES | CCOCCc1nnc(NC(=O)C(=O)c2cc(C)n(-c3ccccc3)c2C)s1 |
| InChI | InChI=1S/C20H22N4O3S/c1-4-27-11-10-17-22-23-20(28-17)21-19(26)18(25)16-12-13(2)24(14(16)3)15-8-6-5-7-9-15/h5-9,12H,4,10-11H2,1-3H3,(H,21,23,26) |
| InChIKey | QNWLSBYFVXOQID-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|