About 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide
2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide (PubChem CID 22515902) has the molecular formula C13H20BrN3O2S
and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide |
| PubChem CID | 22515902 |
| Molecular Formula | C13H20BrN3O2S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide |
| SMILES | CC1CCCC(NS(=O)(=O)c2cc(Br)cnc2N)C1C |
| InChI | InChI=1S/C13H20BrN3O2S/c1-8-4-3-5-11(9(8)2)17-20(18,19)12-6-10(14)7-16-13(12)15/h6-9,11,17H,3-5H2,1-2H3,(H2,15,16) |
| InChIKey | GYIWDYRRVHWRII-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide?
The IUPAC name of 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide (CID 22515902) is 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide.
What is the SMILES notation for 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide?
The canonical SMILES for 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide is CC1CCCC(NS(=O)(=O)c2cc(Br)cnc2N)C1C.
What is the InChIKey of 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide?
The InChIKey is GYIWDYRRVHWRII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20BrN3O2S/c1-8-4-3-5-11(9(8)2)17-20(18,19)12-6-10(14)7-16-13(12)15/h6-9,11,17H,3-5H2,1-2H3,(H2,15,16).
What are the key properties of 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide?
2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide has a molecular weight of 362.29 g/mol, XLogP of 2.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-sulfonamide is sourced from PubChem (CID 22515902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).