About 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one
2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one (PubChem CID 22515955) has the molecular formula C17H12N2O3
and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one |
| PubChem CID | 22515955 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2cccc(O)c2)nc2c1Cc1ccccc1O2 |
| InChI | InChI=1S/C17H12N2O3/c20-12-6-3-5-11(8-12)15-18-16(21)13-9-10-4-1-2-7-14(10)22-17(13)19-15/h1-8,20H,9H2,(H,18,19,21) |
| InChIKey | LOCIWGRVXFKLSN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one (CID 22515955) is 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one is O=c1[nH]c(-c2cccc(O)c2)nc2c1Cc1ccccc1O2.
What is the InChIKey of 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The InChIKey is LOCIWGRVXFKLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O3/c20-12-6-3-5-11(8-12)15-18-16(21)13-9-10-4-1-2-7-14(10)22-17(13)19-15/h1-8,20H,9H2,(H,18,19,21).
What are the key properties of 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one has a molecular weight of 292.29 g/mol, XLogP of 2.84, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxyphenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 22515955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).