C20H21FN4O4S — CID 22516549
7-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-3-methyl-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 22516549) has the molecular formula C20H21FN4O4S and a molecular weight of 432.48 g/mol. Its IUPAC name is 7-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-3-methyl-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-3-methyl-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 22516549 |
| Molecular Formula | C20H21FN4O4S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 7-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-3-methyl-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | CC1C(=O)Nc2ccc(S(=O)(=O)N3CCN(c4ccccc4F)CC3)cc2NC1=O |
| InChI | InChI=1S/C20H21FN4O4S/c1-13-19(26)22-16-7-6-14(12-17(16)23-20(13)27)30(28,29)25-10-8-24(9-11-25)18-5-3-2-4-15(18)21/h2-7,12-13H,8-11H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | VWWOQAVEPXBFEX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|