C16H9N2O5S- — CID 2251702
4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-nitrophenolate (PubChem CID 2251702) has the molecular formula C16H9N2O5S- and a molecular weight of 341.32 g/mol. Its IUPAC name is 4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-nitrophenolate.
| Compound Name | 4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 2251702 |
| Molecular Formula | C16H9N2O5S- |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-nitrophenolate |
| SMILES | O=C1S/C(=C/c2ccc([O-])c([N+](=O)[O-])c2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H10N2O5S/c19-13-7-6-10(8-12(13)18(22)23)9-14-15(20)17(16(21)24-14)11-4-2-1-3-5-11/h1-9,19H/p-1/b14-9+ |
| InChIKey | BKCLDODIPVFQTK-NTEUORMPSA-M |
| XLogP | 2.91 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|