C20H26N4OS — CID 22517177
1-methyl-N-(3-piperidin-1-ylpropyl)-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide (PubChem CID 22517177) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-methyl-N-(3-piperidin-1-ylpropyl)-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide.
| Compound Name | 1-methyl-N-(3-piperidin-1-ylpropyl)-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 22517177 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-methyl-N-(3-piperidin-1-ylpropyl)-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCCCN2CCCCC2)c2c1-c1ccccc1SC2 |
| InChI | InChI=1S/C20H26N4OS/c1-23-19-15-8-3-4-9-17(15)26-14-16(19)18(22-23)20(25)21-10-7-13-24-11-5-2-6-12-24/h3-4,8-9H,2,5-7,10-14H2,1H3,(H,21,25) |
| InChIKey | OJMJJXMZYFKJLZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|