C13H16N4O3S2 — CID 22517468
3-methyl-N-[5-(phenylsulfamoyl)-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 22517468) has the molecular formula C13H16N4O3S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-methyl-N-[5-(phenylsulfamoyl)-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | 3-methyl-N-[5-(phenylsulfamoyl)-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 22517468 |
| Molecular Formula | C13H16N4O3S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3-methyl-N-[5-(phenylsulfamoyl)-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CC(C)CC(=O)Nc1nnc(S(=O)(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C13H16N4O3S2/c1-9(2)8-11(18)14-12-15-16-13(21-12)22(19,20)17-10-6-4-3-5-7-10/h3-7,9,17H,8H2,1-2H3,(H,14,15,18) |
| InChIKey | ONVGXRWDKOZXLK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|