C12H20N4O3S2 — CID 22517536
N-[5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 22517536) has the molecular formula C12H20N4O3S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | N-[5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 22517536 |
| Molecular Formula | C12H20N4O3S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nnc(S(=O)(=O)N2CCC(C)CC2)s1 |
| InChI | InChI=1S/C12H20N4O3S2/c1-3-4-10(17)13-11-14-15-12(20-11)21(18,19)16-7-5-9(2)6-8-16/h9H,3-8H2,1-2H3,(H,13,14,17) |
| InChIKey | WNPAKQXZCMALFV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|