C16H22N4O3S2 — CID 22518145
N-[5-[(3,5-dimethylphenyl)-ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 22518145) has the molecular formula C16H22N4O3S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[5-[(3,5-dimethylphenyl)-ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-[(3,5-dimethylphenyl)-ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22518145 |
| Molecular Formula | C16H22N4O3S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-[5-[(3,5-dimethylphenyl)-ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | CCN(c1cc(C)cc(C)c1)S(=O)(=O)c1nnc(NC(=O)C(C)C)s1 |
| InChI | InChI=1S/C16H22N4O3S2/c1-6-20(13-8-11(4)7-12(5)9-13)25(22,23)16-19-18-15(24-16)17-14(21)10(2)3/h7-10H,6H2,1-5H3,(H,17,18,21) |
| InChIKey | OKABEMAFHUXGEV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|