C24H29N3O4S — CID 22518713
2-[methyl-(1,3,3-trimethyl-2-oxoindol-5-yl)sulfonylamino]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 22518713) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 2-[methyl-(1,3,3-trimethyl-2-oxoindol-5-yl)sulfonylamino]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[methyl-(1,3,3-trimethyl-2-oxoindol-5-yl)sulfonylamino]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 22518713 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-[methyl-(1,3,3-trimethyl-2-oxoindol-5-yl)sulfonylamino]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | CN1C(=O)C(C)(C)c2cc(S(=O)(=O)N(C)CC(=O)NC3CCCc4ccccc43)ccc21 |
| InChI | InChI=1S/C24H29N3O4S/c1-24(2)19-14-17(12-13-21(19)27(4)23(24)29)32(30,31)26(3)15-22(28)25-20-11-7-9-16-8-5-6-10-18(16)20/h5-6,8,10,12-14,20H,7,9,11,15H2,1-4H3,(H,25,28) |
| InChIKey | HFKLTYVUWPHLPY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |