C19H24O3 — CID 2251913
1-[4-(3-methoxyphenoxy)butoxy]-3,5-dimethylbenzene (PubChem CID 2251913) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-[4-(3-methoxyphenoxy)butoxy]-3,5-dimethylbenzene.
| Compound Name | 1-[4-(3-methoxyphenoxy)butoxy]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 2251913 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-[4-(3-methoxyphenoxy)butoxy]-3,5-dimethylbenzene |
| SMILES | COc1cccc(OCCCCOc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C19H24O3/c1-15-11-16(2)13-19(12-15)22-10-5-4-9-21-18-8-6-7-17(14-18)20-3/h6-8,11-14H,4-5,9-10H2,1-3H3 |
| InChIKey | NPSYCVBRJROEIM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|