C21H28N4O3S — CID 22519989
1-methyl-N-[3-(3-methylpiperidin-1-yl)propyl]-5,5-dioxo-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide (PubChem CID 22519989) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-methyl-N-[3-(3-methylpiperidin-1-yl)propyl]-5,5-dioxo-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide.
| Compound Name | 1-methyl-N-[3-(3-methylpiperidin-1-yl)propyl]-5,5-dioxo-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 22519989 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 1-methyl-N-[3-(3-methylpiperidin-1-yl)propyl]-5,5-dioxo-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide |
| SMILES | CC1CCCN(CCCNC(=O)c2nn(C)c3c2CS(=O)(=O)c2ccccc2-3)C1 |
| InChI | InChI=1S/C21H28N4O3S/c1-15-7-5-11-25(13-15)12-6-10-22-21(26)19-17-14-29(27,28)18-9-4-3-8-16(18)20(17)24(2)23-19/h3-4,8-9,15H,5-7,10-14H2,1-2H3,(H,22,26) |
| InChIKey | RIUQQNMSTBTXQE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|