C16H21N3O5 — CID 22520128
5-[(3,4-dimethoxyphenyl)methyl]-N-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 22520128) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methyl]-N-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methyl]-N-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 22520128 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methyl]-N-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | COCCCNC(=O)c1nnc(Cc2ccc(OC)c(OC)c2)o1 |
| InChI | InChI=1S/C16H21N3O5/c1-21-8-4-7-17-15(20)16-19-18-14(24-16)10-11-5-6-12(22-2)13(9-11)23-3/h5-6,9H,4,7-8,10H2,1-3H3,(H,17,20) |
| InChIKey | LSPBCMLNCMVQLQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|