C22H24N4O5S — CID 22520216
2-[2,3-dioxo-4-[2-(4-sulfamoylphenyl)ethyl]pyrazin-1-yl]-N-(3-ethylphenyl)acetamide (PubChem CID 22520216) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is 2-[2,3-dioxo-4-[2-(4-sulfamoylphenyl)ethyl]pyrazin-1-yl]-N-(3-ethylphenyl)acetamide.
| Compound Name | 2-[2,3-dioxo-4-[2-(4-sulfamoylphenyl)ethyl]pyrazin-1-yl]-N-(3-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 22520216 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-[2,3-dioxo-4-[2-(4-sulfamoylphenyl)ethyl]pyrazin-1-yl]-N-(3-ethylphenyl)acetamide |
| SMILES | CCc1cccc(NC(=O)Cn2ccn(CCc3ccc(S(N)(=O)=O)cc3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C22H24N4O5S/c1-2-16-4-3-5-18(14-16)24-20(27)15-26-13-12-25(21(28)22(26)29)11-10-17-6-8-19(9-7-17)32(23,30)31/h3-9,12-14H,2,10-11,15H2,1H3,(H,24,27)(H2,23,30,31) |
| InChIKey | BSYFXBGVNFFWIR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|