C25H30N4O2S — CID 22520897
5-[3-[(2,5-dimethylphenyl)methyl]-1,3-diazinane-1-carbonyl]-4-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one (PubChem CID 22520897) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is 5-[3-[(2,5-dimethylphenyl)methyl]-1,3-diazinane-1-carbonyl]-4-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one.
| Compound Name | 5-[3-[(2,5-dimethylphenyl)methyl]-1,3-diazinane-1-carbonyl]-4-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 22520897 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 5-[3-[(2,5-dimethylphenyl)methyl]-1,3-diazinane-1-carbonyl]-4-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
| SMILES | Cc1ccc(C)c(CN2CCCN(C(=O)c3sc4nc5n(c(=O)c4c3C)CCCC5)C2)c1 |
| InChI | InChI=1S/C25H30N4O2S/c1-16-8-9-17(2)19(13-16)14-27-10-6-11-28(15-27)25(31)22-18(3)21-23(32-22)26-20-7-4-5-12-29(20)24(21)30/h8-9,13H,4-7,10-12,14-15H2,1-3H3 |
| InChIKey | SCNQWWNAIUAWPA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |