About ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate
ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate (PubChem CID 22520973) has the molecular formula C15H17NO4S
and a molecular weight of 307.37 g/mol. Its IUPAC name is ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate |
| PubChem CID | 22520973 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)c1cccc2c1SCCC2=O |
| InChI | InChI=1S/C15H17NO4S/c1-3-20-15(19)9(2)16-14(18)11-6-4-5-10-12(17)7-8-21-13(10)11/h4-6,9H,3,7-8H2,1-2H3,(H,16,18) |
| InChIKey | SBOUZVHEWHFQGP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate?
The IUPAC name of ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate (CID 22520973) is ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate.
What is the SMILES notation for ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate?
The canonical SMILES for ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate is CCOC(=O)C(C)NC(=O)c1cccc2c1SCCC2=O.
What is the InChIKey of ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate?
The InChIKey is SBOUZVHEWHFQGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO4S/c1-3-20-15(19)9(2)16-14(18)11-6-4-5-10-12(17)7-8-21-13(10)11/h4-6,9H,3,7-8H2,1-2H3,(H,16,18).
What are the key properties of ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate?
ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate has a molecular weight of 307.37 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4-oxo-2,3-dihydrothiochromene-8-carbonyl)amino]propanoate is sourced from PubChem (CID 22520973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).