About [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium
[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium (PubChem CID 2252174) has the molecular formula C10H11N6O2+
and a molecular weight of 247.24 g/mol. Its IUPAC name is [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium.
Molecular Properties
| Compound Name | [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium |
| PubChem CID | 2252174 |
| Molecular Formula | C10H11N6O2+ |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium |
| SMILES | NC(=N[NH+]=Cc1ccccc1O)c1nonc1N |
| InChI | InChI=1S/C10H10N6O2/c11-9(8-10(12)16-18-15-8)14-13-5-6-3-1-2-4-7(6)17/h1-5,17H,(H2,11,14)(H2,12,16)/p+1 |
| InChIKey | AUZNLHHMEIQCHP-UHFFFAOYSA-O |
| XLogP | -1.82 |
| TPSA | 137.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium?
The IUPAC name of [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium (CID 2252174) is [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium.
What is the SMILES notation for [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium?
The canonical SMILES for [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium is NC(=N[NH+]=Cc1ccccc1O)c1nonc1N.
What is the InChIKey of [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium?
The InChIKey is AUZNLHHMEIQCHP-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H10N6O2/c11-9(8-10(12)16-18-15-8)14-13-5-6-3-1-2-4-7(6)17/h1-5,17H,(H2,11,14)(H2,12,16)/p+1.
What are the key properties of [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium?
[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium has a molecular weight of 247.24 g/mol, XLogP of -1.82, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxyphenyl)methylidene]azanium is sourced from PubChem (CID 2252174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).