About 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide
4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 2252175) has the molecular formula C10H10N6O2
and a molecular weight of 246.23 g/mol. Its IUPAC name is 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
Molecular Properties
| Compound Name | 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| PubChem CID | 2252175 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NC(=NN=Cc1ccccc1O)c1nonc1N |
| InChI | InChI=1S/C10H10N6O2/c11-9(8-10(12)16-18-15-8)14-13-5-6-3-1-2-4-7(6)17/h1-5,17H,(H2,11,14)(H2,12,16) |
| InChIKey | AUZNLHHMEIQCHP-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 135.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide?
The IUPAC name of 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (CID 2252175) is 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
What is the SMILES notation for 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide?
The canonical SMILES for 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide is NC(=NN=Cc1ccccc1O)c1nonc1N.
What is the InChIKey of 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide?
The InChIKey is AUZNLHHMEIQCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N6O2/c11-9(8-10(12)16-18-15-8)14-13-5-6-3-1-2-4-7(6)17/h1-5,17H,(H2,11,14)(H2,12,16).
What are the key properties of 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide?
4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide has a molecular weight of 246.23 g/mol, XLogP of 0.10, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N'-[(2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide is sourced from PubChem (CID 2252175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).